CAS 1803608-74-3 is the registry number for 1-(Cyclohexylmethyl)-1H-1,2,3-triazole-4-carboximidamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(cyclohexylmethyl)triazole-4-carboximidamide;hydrochloride (CAS 1803608-74-3) is a chemical compound with the molecular formula C10H18ClN5 and a molecular weight of 243.74 g/mol. IUPAC name: 1-(cyclohexylmethyl)triazole-4-carboximidamide;hydrochloride. InChIKey: DXKUXLJDYNLVLP-UHFFFAOYSA-N.
| Molecular formula | C10H18ClN5 |
|---|---|
| Molecular weight | 243.74 g/mol |
| IUPAC name | 1-(cyclohexylmethyl)triazole-4-carboximidamide;hydrochloride |
| InChIKey | DXKUXLJDYNLVLP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CN2C=C(N=N2)C(=N)N.Cl |
Computed by PubChem (NCBI)