CAS 1803609-17-7 appears in our catalog under these names: lithium(1+) ion 5-methyl-1,3-oxazole-2-carboxylate, 95%, 5-Methyl-1,3-oxazole-2-carboxylate lithium(I). Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
Lithium 5-methyl-1,3-oxazole-2-carboxylate (CAS 1803609-17-7) is a chemical compound with the molecular formula C5H4LiNO3 and a molecular weight of 133.1 g/mol. IUPAC name: lithium 5-methyl-1,3-oxazole-2-carboxylate. InChIKey: NOSIKVDFPLHGBD-UHFFFAOYSA-M.
| Molecular formula | C5H4LiNO3 |
|---|---|
| Molecular weight | 133.1 g/mol |
| IUPAC name | lithium 5-methyl-1,3-oxazole-2-carboxylate |
| InChIKey | NOSIKVDFPLHGBD-UHFFFAOYSA-M |
| SMILES | [Li+].CC1=CN=C(O1)C(=O)[O-] |
Computed by PubChem (NCBI)