CAS 1803610-34-5 is the registry number for Ethyl 2,5-dimethyl-1,3-thiazole-4-carboxylate hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2,5-dimethyl-1,3-thiazole-4-carboxylate;hydrobromide (CAS 1803610-34-5) is a chemical compound with the molecular formula C8H12BrNO2S and a molecular weight of 266.16 g/mol. IUPAC name: ethyl 2,5-dimethyl-1,3-thiazole-4-carboxylate;hydrobromide. InChIKey: IOXJPPPFXCHLAE-UHFFFAOYSA-N.
| Molecular formula | C8H12BrNO2S |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | ethyl 2,5-dimethyl-1,3-thiazole-4-carboxylate;hydrobromide |
| InChIKey | IOXJPPPFXCHLAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)C)C.Br |
Computed by PubChem (NCBI)