CAS 1803611-95-1 appears in our catalog under these names: 2-(5-Bromopyrimidin-4-yl)acetic acid, sodium salt, 95+%, Sodium 2-(5-bromopyrimidin-4-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-(5-bromopyrimidin-4-yl)acetate (CAS 1803611-95-1) is a chemical compound with the molecular formula C6H4BrN2NaO2 and a molecular weight of 239.00 g/mol. IUPAC name: sodium 2-(5-bromopyrimidin-4-yl)acetate. InChIKey: OMBZVUFCLOBSBV-UHFFFAOYSA-M.
| Molecular formula | C6H4BrN2NaO2 |
|---|---|
| Molecular weight | 239.00 g/mol |
| IUPAC name | sodium 2-(5-bromopyrimidin-4-yl)acetate |
| InChIKey | OMBZVUFCLOBSBV-UHFFFAOYSA-M |
| SMILES | C1=C(C(=NC=N1)CC(=O)[O-])Br.[Na+] |
Computed by PubChem (NCBI)