CAS 1803612-06-7 is the registry number for 2-Bromo-4-(trifluoromethyl)pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-bromo-4-(trifluoromethyl)pyridine;hydrochloride (CAS 1803612-06-7) is a chemical compound with the molecular formula C6H4BrClF3N and a molecular weight of 262.45 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)pyridine;hydrochloride. InChIKey: IQPYDWXKZNZQBL-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClF3N |
|---|---|
| Molecular weight | 262.45 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | IQPYDWXKZNZQBL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(F)(F)F)Br.Cl |
Computed by PubChem (NCBI)