Products 1803612-22-7
CAS 1803612-22-7 is the registry number for tert-Butyl N-{(3-(3,4-dimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[[3-(3,4-dimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]carbamate (CAS 1803612-22-7) is a chemical compound with the molecular formula C17H24N2O3 and a molecular weight of 304.4 g/mol. IUPAC name: tert-butyl N-[[3-(3,4-dimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]carbamate. InChIKey: KKPSBLMEUDTRKD-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tert-butyl N-[[3-(3,4-dimethylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]carbamate |
| InChIKey | KKPSBLMEUDTRKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NOC(C2)CNC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)