Products 1803754-22-4
CAS 1803754-22-4 is the registry number for 4-Amino-5-fluoro-2-(trifluoromethoxy)benzonitrile, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-fluoro-2-(trifluoromethoxy)benzonitrile (CAS 1803754-22-4) is a chemical compound with the molecular formula C8H4F4N2O and a molecular weight of 220.12 g/mol. IUPAC name: 4-amino-5-fluoro-2-(trifluoromethoxy)benzonitrile. InChIKey: CEBSAIPJECOFMI-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2O |
|---|---|
| Molecular weight | 220.12 g/mol |
| IUPAC name | 4-amino-5-fluoro-2-(trifluoromethoxy)benzonitrile |
| InChIKey | CEBSAIPJECOFMI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)N)OC(F)(F)F)C#N |
Computed by PubChem (NCBI)