CAS 18038-55-6 appears in our catalog under these names: Bis(trichlorosilyl)acetylene, 95%, Bis(trichlorosilyl)acetylene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 200mg.
Trichloro(2-trichlorosilylethynyl)silane (CAS 18038-55-6) is a chemical compound with the molecular formula C2Cl6Si2 and a molecular weight of 292.9 g/mol. IUPAC name: trichloro(2-trichlorosilylethynyl)silane. InChIKey: YVAMNMBARCMOTI-UHFFFAOYSA-N.
| Molecular formula | C2Cl6Si2 |
|---|---|
| Molecular weight | 292.9 g/mol |
| IUPAC name | trichloro(2-trichlorosilylethynyl)silane |
| InChIKey | YVAMNMBARCMOTI-UHFFFAOYSA-N |
| SMILES | C(#C[Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)