Products 1803904-83-7
CAS 1803904-83-7 is the registry number for 2-Chloro-4-fluoro-6-(trifluoromethyl)-1H-1,3-benzimidazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-fluoro-6-(trifluoromethyl)-1H-benzimidazole (CAS 1803904-83-7) is a chemical compound with the molecular formula C8H3ClF4N2 and a molecular weight of 238.57 g/mol. IUPAC name: 2-chloro-4-fluoro-6-(trifluoromethyl)-1H-benzimidazole. InChIKey: IONQRSZIWFWFDM-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4N2 |
|---|---|
| Molecular weight | 238.57 g/mol |
| IUPAC name | 2-chloro-4-fluoro-6-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | IONQRSZIWFWFDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=N2)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)