Products 1804129-06-3

CAS 1804129-06-3 is the registry number for 2,2-Diethylthiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,2-diethyl-1,4-thiazinane 1,1-dioxide (CAS 1804129-06-3) is a chemical compound with the molecular formula C8H17NO2S and a molecular weight of 191.29 g/mol. IUPAC name: 2,2-diethyl-1,4-thiazinane 1,1-dioxide. InChIKey: CMPUHVSGPDKAOX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17NO2S
Molecular weight191.29 g/mol
IUPAC name2,2-diethyl-1,4-thiazinane 1,1-dioxide
InChIKeyCMPUHVSGPDKAOX-UHFFFAOYSA-N
SMILESCCC1(CNCCS1(=O)=O)CC

Computed by PubChem (NCBI)