CAS 180421-64-1 appears in our catalog under these names: 5-Chloroquinoline-6-carbaldehyde, 95%, 5-Chloroquinoline-6-carbaldehyde, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
5-chloroquinoline-6-carbaldehyde (CAS 180421-64-1) is a chemical compound with the molecular formula C10H6ClNO and a molecular weight of 191.61 g/mol. IUPAC name: 5-chloroquinoline-6-carbaldehyde. InChIKey: YGJBHHLOSCPCTK-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | 5-chloroquinoline-6-carbaldehyde |
| InChIKey | YGJBHHLOSCPCTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2Cl)C=O)N=C1 |
Computed by PubChem (NCBI)