CAS 18048-87-8 is the registry number for L-Cysteinyl-L-cysteine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
Cys-Cys is a dipeptide formed from two L-cysteine residues. It has a role as a Mycoplasma genitalium metabolite. It is functionally related to a L-cysteine.
Source: ChEBI
| Molecular formula | C6H12N2O3S2 |
|---|---|
| Molecular weight | 224.3 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoic acid |
| InChIKey | OABOXRPGTFRBFZ-IMJSIDKUSA-N |
| SMILES | C([C@@H](C(=O)N[C@@H](CS)C(=O)O)N)S |
Computed by PubChem (NCBI)