CAS 1804892-46-3 appears in our catalog under these names: Methyl 4-cyano-3,5-dibromophenylacetate, 95%, Methyl 2–(3,5–dibromo–4–cyanophenyl)acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-(3,5-dibromo-4-cyanophenyl)acetate (CAS 1804892-46-3) is a chemical compound with the molecular formula C10H7Br2NO2 and a molecular weight of 332.98 g/mol. IUPAC name: methyl 2-(3,5-dibromo-4-cyanophenyl)acetate. InChIKey: JPVUPQYZPWFAHH-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO2 |
|---|---|
| Molecular weight | 332.98 g/mol |
| IUPAC name | methyl 2-(3,5-dibromo-4-cyanophenyl)acetate |
| InChIKey | JPVUPQYZPWFAHH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C(=C1)Br)C#N)Br |
Computed by PubChem (NCBI)