CAS 1804934-57-3 is the registry number for Metallo-β-lactamase-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1R,3aS)-3,3a-dihydro-1H-[1,3]thiazolo[4,3-b][1,3]benzothiazol-1-yl]methanethiol (CAS 1804934-57-3) is a chemical compound with the molecular formula C10H11NS3 and a molecular weight of 241.4 g/mol. IUPAC name: [(1R,3aS)-3,3a-dihydro-1H-[1,3]thiazolo[4,3-b][1,3]benzothiazol-1-yl]methanethiol. InChIKey: MEJQWEINVXTSHQ-ZJUUUORDSA-N.
| Molecular formula | C10H11NS3 |
|---|---|
| Molecular weight | 241.4 g/mol |
| IUPAC name | [(1R,3aS)-3,3a-dihydro-1H-[1,3]thiazolo[4,3-b][1,3]benzothiazol-1-yl]methanethiol |
| InChIKey | MEJQWEINVXTSHQ-ZJUUUORDSA-N |
| SMILES | C1[C@H]2N([C@H](S1)CS)C3=CC=CC=C3S2 |
Computed by PubChem (NCBI)