Products 1805026-31-6

CAS 1805026-31-6 is the registry number for 1,3-dibromo-2-chloro-4-fluorobenzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1,3-dibromo-2-chloro-4-fluorobenzene (CAS 1805026-31-6) is a chemical compound with the molecular formula C6H2Br2ClF and a molecular weight of 288.34 g/mol. IUPAC name: 1,3-dibromo-2-chloro-4-fluorobenzene. InChIKey: GWLGOLDXPHQZTP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Br2ClF
Molecular weight288.34 g/mol
IUPAC name1,3-dibromo-2-chloro-4-fluorobenzene
InChIKeyGWLGOLDXPHQZTP-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)Br)Cl)Br

Computed by PubChem (NCBI)