CAS 1805038-94-1 is the registry number for 3-Chloro-2-(trifluoromethyl)pyridine-4-thiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-2-(trifluoromethyl)-1H-pyridine-4-thione (CAS 1805038-94-1) is a chemical compound with the molecular formula C6H3ClF3NS and a molecular weight of 213.61 g/mol. IUPAC name: 3-chloro-2-(trifluoromethyl)-1H-pyridine-4-thione. InChIKey: YDJFYHHFXYZXOR-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NS |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 3-chloro-2-(trifluoromethyl)-1H-pyridine-4-thione |
| InChIKey | YDJFYHHFXYZXOR-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C(C1=S)Cl)C(F)(F)F |
Computed by PubChem (NCBI)