CAS 1805081-70-2 is the registry number for 4-iodo-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-iodo-1,3-benzoxazol-2-amine (CAS 1805081-70-2) is a chemical compound with the molecular formula C7H5IN2O and a molecular weight of 260.03 g/mol. IUPAC name: 4-iodo-1,3-benzoxazol-2-amine. InChIKey: JMJGDFRCCXNGAN-UHFFFAOYSA-N.
| Molecular formula | C7H5IN2O |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 4-iodo-1,3-benzoxazol-2-amine |
| InChIKey | JMJGDFRCCXNGAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)N=C(O2)N |
Computed by PubChem (NCBI)