CAS 1805120-01-7 is the registry number for Apalutamide Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
6-nitro-3-(trifluoromethyl)pyridine-2-carbonitrile (CAS 1805120-01-7) is a chemical compound with the molecular formula C7H2F3N3O2 and a molecular weight of 217.10 g/mol. IUPAC name: 6-nitro-3-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: KUXHWBIXZKKKAL-UHFFFAOYSA-N.
| Molecular formula | C7H2F3N3O2 |
|---|---|
| Molecular weight | 217.10 g/mol |
| IUPAC name | 6-nitro-3-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | KUXHWBIXZKKKAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)