CAS 1805190-12-8 appears in our catalog under these names: 2-Bromo-5-fluoro-4-nitrobenzonitrile, 98%, 2-Bromo-5-fluoro-4-nitrobenzonitrile, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-bromo-5-fluoro-4-nitrobenzonitrile (CAS 1805190-12-8) is a chemical compound with the molecular formula C7H2BrFN2O2 and a molecular weight of 245.01 g/mol. IUPAC name: 2-bromo-5-fluoro-4-nitrobenzonitrile. InChIKey: CXRKHIFTNAZKPD-UHFFFAOYSA-N.
| Molecular formula | C7H2BrFN2O2 |
|---|---|
| Molecular weight | 245.01 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-nitrobenzonitrile |
| InChIKey | CXRKHIFTNAZKPD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])Br)C#N |
Computed by PubChem (NCBI)