CAS 18052-85-2 is the registry number for 2-(Trimethylsilyl)naphthalene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g.
Trimethyl(naphthalen-2-yl)silane (CAS 18052-85-2) is a chemical compound with the molecular formula C13H16Si and a molecular weight of 200.35 g/mol. IUPAC name: trimethyl(naphthalen-2-yl)silane. InChIKey: FSTJPXXIHGWZIV-UHFFFAOYSA-N.
| Molecular formula | C13H16Si |
|---|---|
| Molecular weight | 200.35 g/mol |
| IUPAC name | trimethyl(naphthalen-2-yl)silane |
| InChIKey | FSTJPXXIHGWZIV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)