CAS 1805471-07-1 is the registry number for 3-Chloro-4-methyl-2-nitroaniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
3-chloro-4-methyl-2-nitroaniline (CAS 1805471-07-1) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-4-methyl-2-nitroaniline. InChIKey: LAZJONCASXDNSF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-4-methyl-2-nitroaniline |
| InChIKey | LAZJONCASXDNSF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)