Products 1805475-28-8

CAS 1805475-28-8 is the registry number for 3-Chloro-2,5,6-trifluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-chloro-2,5,6-trifluorobenzoic acid (CAS 1805475-28-8) is a chemical compound with the molecular formula C7H2ClF3O2 and a molecular weight of 210.54 g/mol. IUPAC name: 3-chloro-2,5,6-trifluorobenzoic acid. InChIKey: PDVQXJLIUSHKMV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2ClF3O2
Molecular weight210.54 g/mol
IUPAC name3-chloro-2,5,6-trifluorobenzoic acid
InChIKeyPDVQXJLIUSHKMV-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1Cl)F)C(=O)O)F)F

Computed by PubChem (NCBI)