CAS 18055-70-4 is the registry number for 1,3-Di(p-tolyl)-1,1,3,3-tetramethyldisiloxane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[dimethyl-(4-methylphenyl)silyl]oxy-dimethyl-(4-methylphenyl)silane (CAS 18055-70-4) is a chemical compound with the molecular formula C18H26OSi2 and a molecular weight of 314.6 g/mol. IUPAC name: [dimethyl-(4-methylphenyl)silyl]oxy-dimethyl-(4-methylphenyl)silane. InChIKey: MEQYEVSZYLVDNX-UHFFFAOYSA-N.
| Molecular formula | C18H26OSi2 |
|---|---|
| Molecular weight | 314.6 g/mol |
| IUPAC name | [dimethyl-(4-methylphenyl)silyl]oxy-dimethyl-(4-methylphenyl)silane |
| InChIKey | MEQYEVSZYLVDNX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)[Si](C)(C)O[Si](C)(C)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)