CAS 1805510-05-7 is the registry number for 4-Bromo-2,6-bis(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-bromo-2,6-bis(trifluoromethyl)aniline (CAS 1805510-05-7) is a chemical compound with the molecular formula C8H4BrF6N and a molecular weight of 308.02 g/mol. IUPAC name: 4-bromo-2,6-bis(trifluoromethyl)aniline. InChIKey: DDESBCKMFLXTKC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF6N |
|---|---|
| Molecular weight | 308.02 g/mol |
| IUPAC name | 4-bromo-2,6-bis(trifluoromethyl)aniline |
| InChIKey | DDESBCKMFLXTKC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)C(F)(F)F)Br |
Computed by PubChem (NCBI)