Products 1805587-94-3
CAS 1805587-94-3 is the registry number for 4-Amino-2,5-bis(trifluoromethyl)phenol. Offered by: TRC. Available pack sizes: 25mg.
4-amino-2,5-bis(trifluoromethyl)phenol (CAS 1805587-94-3) is a chemical compound with the molecular formula C8H5F6NO and a molecular weight of 245.12 g/mol. IUPAC name: 4-amino-2,5-bis(trifluoromethyl)phenol. InChIKey: ORFQDRFRWVRQKB-UHFFFAOYSA-N.
| Molecular formula | C8H5F6NO |
|---|---|
| Molecular weight | 245.12 g/mol |
| IUPAC name | 4-amino-2,5-bis(trifluoromethyl)phenol |
| InChIKey | ORFQDRFRWVRQKB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)