CAS 1806-49-1 is the registry number for (Chloromethyl)diphenylphosphine Oxide. Offered by: TRC. Available pack sizes: 100mg.
[chloromethyl(phenyl)phosphoryl]benzene (CAS 1806-49-1) is a chemical compound with the molecular formula C13H12ClOP and a molecular weight of 250.66 g/mol. IUPAC name: [chloromethyl(phenyl)phosphoryl]benzene. InChIKey: IGPFFLDNJJJXHV-UHFFFAOYSA-N.
| Molecular formula | C13H12ClOP |
|---|---|
| Molecular weight | 250.66 g/mol |
| IUPAC name | [chloromethyl(phenyl)phosphoryl]benzene |
| InChIKey | IGPFFLDNJJJXHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)