CAS 1806273-96-0 appears in our catalog under these names: 2,4-Difluoro-6-methoxybenzenesulfonamide, 97%, 2,4-Difluoro-6-methoxybenzenesulfonamide, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg, 2.5g.
2,4-difluoro-6-methoxybenzenesulfonamide (CAS 1806273-96-0) is a chemical compound with the molecular formula C7H7F2NO3S and a molecular weight of 223.20 g/mol. IUPAC name: 2,4-difluoro-6-methoxybenzenesulfonamide. InChIKey: WAFSOOCJSNNPKH-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NO3S |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 2,4-difluoro-6-methoxybenzenesulfonamide |
| InChIKey | WAFSOOCJSNNPKH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)