CAS 1806276-05-0 appears in our catalog under these names: 2,6-Dichloro-4-(difluoromethoxy)benzyl alcohol, 95%, 2,6–Dichloro–4–(difluoromethoxy)benzyl alcohol, 2,6-Dichloro-4-(difluoromethoxy)benzyl alcohol, 95%, 95%, 2,6-DICHLORO-4-(DIFLUOROMETHOXY)BENZYL ALCOHOL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[2,6-dichloro-4-(difluoromethoxy)phenyl]methanol (CAS 1806276-05-0) is a chemical compound with the molecular formula C8H6Cl2F2O2 and a molecular weight of 243.03 g/mol. IUPAC name: [2,6-dichloro-4-(difluoromethoxy)phenyl]methanol. InChIKey: IXWAFMFGMDHDMW-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F2O2 |
|---|---|
| Molecular weight | 243.03 g/mol |
| IUPAC name | [2,6-dichloro-4-(difluoromethoxy)phenyl]methanol |
| InChIKey | IXWAFMFGMDHDMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CO)Cl)OC(F)F |
Computed by PubChem (NCBI)