Products 1806305-39-4
CAS 1806305-39-4 is the registry number for 3,5-Difluoro-4-(trifluoromethoxy)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-difluoro-4-(trifluoromethoxy)aniline (CAS 1806305-39-4) is a chemical compound with the molecular formula C7H4F5NO and a molecular weight of 213.10 g/mol. IUPAC name: 3,5-difluoro-4-(trifluoromethoxy)aniline. InChIKey: VXWCYNJUPCSXGF-UHFFFAOYSA-N.
| Molecular formula | C7H4F5NO |
|---|---|
| Molecular weight | 213.10 g/mol |
| IUPAC name | 3,5-difluoro-4-(trifluoromethoxy)aniline |
| InChIKey | VXWCYNJUPCSXGF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)(F)F)F)N |
Computed by PubChem (NCBI)