CAS 1806314-81-7 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethoxy)benzonitrile, 95%, 2,4-Difluoro-3-(trifluoromethoxy)benzonitrile, 97%, 2,4-Difluoro-3-(trifluoromethoxy)benzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
2,4-difluoro-3-(trifluoromethoxy)benzonitrile (CAS 1806314-81-7) is a chemical compound with the molecular formula C8H2F5NO and a molecular weight of 223.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethoxy)benzonitrile. InChIKey: HJESAQICKUPRBX-UHFFFAOYSA-N.
| Molecular formula | C8H2F5NO |
|---|---|
| Molecular weight | 223.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethoxy)benzonitrile |
| InChIKey | HJESAQICKUPRBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)OC(F)(F)F)F |
Computed by PubChem (NCBI)