CAS 1806379-17-8 appears in our catalog under these names: 2-amino-1,3-benzoxazole-6-carbonitrile, 95%, 2-Amino-1,3-benzoxazole-6-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
2-amino-1,3-benzoxazole-6-carbonitrile (CAS 1806379-17-8) is a chemical compound with the molecular formula C8H5N3O and a molecular weight of 159.14 g/mol. IUPAC name: 2-amino-1,3-benzoxazole-6-carbonitrile. InChIKey: DKVFUVHAXZPHRG-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | 2-amino-1,3-benzoxazole-6-carbonitrile |
| InChIKey | DKVFUVHAXZPHRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)OC(=N2)N |
Computed by PubChem (NCBI)