Products 1806418-49-4

CAS 1806418-49-4 is the registry number for 2-Fluoro-4-methoxy-1,3-dimethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-1-methoxy-2,4-dimethylbenzene (CAS 1806418-49-4) is a chemical compound with the molecular formula C9H11FO and a molecular weight of 154.18 g/mol. IUPAC name: 3-fluoro-1-methoxy-2,4-dimethylbenzene. InChIKey: IODKMVCMLMZAAR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11FO
Molecular weight154.18 g/mol
IUPAC name3-fluoro-1-methoxy-2,4-dimethylbenzene
InChIKeyIODKMVCMLMZAAR-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)OC)C)F

Computed by PubChem (NCBI)