CAS 1806491-69-9 is the registry number for METHYL 4-FLUORO-6-METHOXYNICOTINATE, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 4-fluoro-6-methoxypyridine-3-carboxylate (CAS 1806491-69-9) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: methyl 4-fluoro-6-methoxypyridine-3-carboxylate. InChIKey: FNCSPDMYLTVPPW-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | methyl 4-fluoro-6-methoxypyridine-3-carboxylate |
| InChIKey | FNCSPDMYLTVPPW-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)F)C(=O)OC |
Computed by PubChem (NCBI)