CAS 1806664-27-6 is the registry number for 7-Bromo-2-fluoro-1H-benzimidazole. Offered by: TRC. Available pack sizes: 500mg.
4-bromo-2-fluoro-1H-benzimidazole (CAS 1806664-27-6) is a chemical compound with the molecular formula C7H4BrFN2 and a molecular weight of 215.02 g/mol. IUPAC name: 4-bromo-2-fluoro-1H-benzimidazole. InChIKey: FPUWGVIHVAZOOR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2 |
|---|---|
| Molecular weight | 215.02 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1H-benzimidazole |
| InChIKey | FPUWGVIHVAZOOR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(N2)F |
Computed by PubChem (NCBI)