CAS 180675-22-3 appears in our catalog under these names: (1,3–Dioxolan–2–ylMethyl)MagnesiuM broMide, (1,3-Dioxolan-2-ylmethyl)magnesium bromide, 0.5M solution in THF, AcroSeal®, (1,3-DIOXOLAN-2-YLMETHYL)MAGNESIUM &, (1,3-DIOXOLAN-2-YLMETHYL)MAGNESIUM. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ml, 800ML, 1L.
Magnesium;2-methanidyl-1,3-dioxolane;bromide (CAS 180675-22-3) is a chemical compound with the molecular formula C4H7BrMgO2 and a molecular weight of 191.31 g/mol. IUPAC name: magnesium;2-methanidyl-1,3-dioxolane;bromide. InChIKey: IERSPCAGKAOLSQ-UHFFFAOYSA-M.
| Molecular formula | C4H7BrMgO2 |
|---|---|
| Molecular weight | 191.31 g/mol |
| IUPAC name | magnesium;2-methanidyl-1,3-dioxolane;bromide |
| InChIKey | IERSPCAGKAOLSQ-UHFFFAOYSA-M |
| SMILES | [CH2-]C1OCCO1.[Mg+2].[Br-] |
Computed by PubChem (NCBI)