CAS 1806853-84-8 appears in our catalog under these names: 2-Bromo-5-nitroisonicotinonitrile, 95%, 2–Bromo–5–nitroisonicotinonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
2-bromo-5-nitropyridine-4-carbonitrile (CAS 1806853-84-8) is a chemical compound with the molecular formula C6H2BrN3O2 and a molecular weight of 228.00 g/mol. IUPAC name: 2-bromo-5-nitropyridine-4-carbonitrile. InChIKey: PUQBVHJPXLBQHO-UHFFFAOYSA-N.
| Molecular formula | C6H2BrN3O2 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | 2-bromo-5-nitropyridine-4-carbonitrile |
| InChIKey | PUQBVHJPXLBQHO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)