Products 1807052-78-3
CAS 1807052-78-3 is the registry number for 3-(Trifluoromethyl)pyridine-2,5-diamine, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
3-(trifluoromethyl)pyridine-2,5-diamine (CAS 1807052-78-3) is a chemical compound with the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. IUPAC name: 3-(trifluoromethyl)pyridine-2,5-diamine. InChIKey: GTFDTBCQEQSKEH-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | 3-(trifluoromethyl)pyridine-2,5-diamine |
| InChIKey | GTFDTBCQEQSKEH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)N)N |
Computed by PubChem (NCBI)