Products 1807119-31-8
CAS 1807119-31-8 appears in our catalog under these names: 1-Bromo-4-fluoro-5-nitro-2-(trifluoromethyl)benzene, 97%, 1-Bromo-4-fluoro-5-nitro-2-(trifluoromethyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-bromo-4-fluoro-5-nitro-2-(trifluoromethyl)benzene (CAS 1807119-31-8) is a chemical compound with the molecular formula C7H2BrF4NO2 and a molecular weight of 287.99 g/mol. IUPAC name: 1-bromo-4-fluoro-5-nitro-2-(trifluoromethyl)benzene. InChIKey: KVCRYFRKEWXZJC-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF4NO2 |
|---|---|
| Molecular weight | 287.99 g/mol |
| IUPAC name | 1-bromo-4-fluoro-5-nitro-2-(trifluoromethyl)benzene |
| InChIKey | KVCRYFRKEWXZJC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])Br)C(F)(F)F |
Computed by PubChem (NCBI)