CAS 1807165-87-2 is the registry number for 2-Bromo-4-fluoro-5-(trifluoromethoxy)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-4-fluoro-5-(trifluoromethoxy)phenol (CAS 1807165-87-2) is a chemical compound with the molecular formula C7H3BrF4O2 and a molecular weight of 274.99 g/mol. IUPAC name: 2-bromo-4-fluoro-5-(trifluoromethoxy)phenol. InChIKey: UZEPDRJGRUMDPP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O2 |
|---|---|
| Molecular weight | 274.99 g/mol |
| IUPAC name | 2-bromo-4-fluoro-5-(trifluoromethoxy)phenol |
| InChIKey | UZEPDRJGRUMDPP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)F)Br)O |
Computed by PubChem (NCBI)