CAS 1807315-98-5 appears in our catalog under these names: Edoxaban Impurity 54, Edoxaban Impurity 19 (1S,2R,4S) Mesylate, 2-Amino Edoxaban Methanesulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
N-[(1S,2R,4S)-2-amino-4-(dimethylcarbamoyl)cyclohexyl]-N'-(5-chloro-2-pyridinyl)oxamide;methanesulfonic acid (CAS 1807315-98-5) is a chemical compound with the molecular formula C17H26ClN5O6S and a molecular weight of 463.9 g/mol. IUPAC name: N-[(1S,2R,4S)-2-amino-4-(dimethylcarbamoyl)cyclohexyl]-N'-(5-chloro-2-pyridinyl)oxamide;methanesulfonic acid. InChIKey: HVPXYAXQJCBREW-CRGLIXAISA-N.
| Molecular formula | C17H26ClN5O6S |
|---|---|
| Molecular weight | 463.9 g/mol |
| IUPAC name | N-[(1S,2R,4S)-2-amino-4-(dimethylcarbamoyl)cyclohexyl]-N'-(5-chloro-2-pyridinyl)oxamide;methanesulfonic acid |
| InChIKey | HVPXYAXQJCBREW-CRGLIXAISA-N |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H]([C@@H](C1)N)NC(=O)C(=O)NC2=NC=C(C=C2)Cl.CS(=O)(=O)O |
Computed by PubChem (NCBI)