CAS 1807501-83-2 appears in our catalog under these names: Endo-bcn-peg4-t-butyl ester, 95%, endo–BCN–PEG4–Boc, Endo-BCN-PEG4-t-butyl ester, Endo-bcn-peg4-t-butyl ester 95%, endo-BCN-PEG4-Boc. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 50mg, 100 mg, 25 mg, 5 mg, 10 mg.
Tert-butyl 3-[2-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807501-83-2) is a chemical compound with the molecular formula C26H43NO8 and a molecular weight of 497.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: BSCLHAMNOSOPKH-UHFFFAOYSA-N.
| Molecular formula | C26H43NO8 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | BSCLHAMNOSOPKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)OCC1C2C1CCC#CCC2 |
Computed by PubChem (NCBI)