CAS 1807503-90-7 appears in our catalog under these names: Ald-ph-peg2-nhboc, 95%, Ald-Ph-PEG2-NH-Boc, Ald–Ph–PEG2–NH–Boc, 5,8-Dioxa-2,11-diazadodecanoic acid, 12-(4-formylphenyl)-12-oxo-, 1,1-dimethylethyl ester, 95%, 95%, Ald-Ph-PEG2-NH-Boc, 95.0%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 5mg, 10mg, 50mg, 1g, 100 mg, 50 mg.
Tert-butyl N-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethyl]carbamate (CAS 1807503-90-7) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethyl]carbamate. InChIKey: MSCITXKKGMUNOD-UHFFFAOYSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | MSCITXKKGMUNOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)