CAS 1807512-37-3 appears in our catalog under these names: Thp-ss-peg1-tos, 95%, THP–SS–PEG1–Tos, THP-SS-PEG1-Tos, THP-SS-PEG1-Tos 95%, 2-((2-((Tetrahydro-2H-pyran-2-yl)oxy)ethyl)disulfaneyl)ethyl 4-methylbenzenesulfonate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 500mg, 250 mg, 25 mg, 50 mg, 100 mg.
2-[2-(oxan-2-yloxy)ethyldisulfanyl]ethyl 4-methylbenzenesulfonate (CAS 1807512-37-3) is a chemical compound with the molecular formula C16H24O5S3 and a molecular weight of 392.6 g/mol. IUPAC name: 2-[2-(oxan-2-yloxy)ethyldisulfanyl]ethyl 4-methylbenzenesulfonate. InChIKey: WJDBLPWPLQRBJB-UHFFFAOYSA-N.
| Molecular formula | C16H24O5S3 |
|---|---|
| Molecular weight | 392.6 g/mol |
| IUPAC name | 2-[2-(oxan-2-yloxy)ethyldisulfanyl]ethyl 4-methylbenzenesulfonate |
| InChIKey | WJDBLPWPLQRBJB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCSSCCOC2CCCCO2 |
Computed by PubChem (NCBI)