CAS 1807518-77-9 appears in our catalog under these names: Fmoc-n-methyl-n-amido-peg2-acid, 95%, Fmoc–N–methyl–PEG3–CH2CH2COOH, Fmoc-NMe-PEG(3)-COOH, Fmoc-nme-PEG2-acid, Fmoc-n-methyl-n-amido-peg2-acid 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 50 mg, 250 mg, 100 mg.
3-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1807518-77-9) is a chemical compound with the molecular formula C25H31NO7 and a molecular weight of 457.5 g/mol. IUPAC name: 3-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: JKEBDIJQSKVIID-UHFFFAOYSA-N.
| Molecular formula | C25H31NO7 |
|---|---|
| Molecular weight | 457.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | JKEBDIJQSKVIID-UHFFFAOYSA-N |
| SMILES | CN(CCOCCOCCOCCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)