Products 1807520-24-6
CAS 1807520-24-6 is the registry number for hCAII-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[[4-[4-(4-bromophenyl)pyrimidin-2-yl]piperazine-1-carbonyl]amino]phenyl] sulfamate (CAS 1807520-24-6) is a chemical compound with the molecular formula C21H21BrN6O4S and a molecular weight of 533.4 g/mol. IUPAC name: [4-[[4-[4-(4-bromophenyl)pyrimidin-2-yl]piperazine-1-carbonyl]amino]phenyl] sulfamate. InChIKey: STFQQFBHIRCAGO-UHFFFAOYSA-N.
| Molecular formula | C21H21BrN6O4S |
|---|---|
| Molecular weight | 533.4 g/mol |
| IUPAC name | [4-[[4-[4-(4-bromophenyl)pyrimidin-2-yl]piperazine-1-carbonyl]amino]phenyl] sulfamate |
| InChIKey | STFQQFBHIRCAGO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=CC(=N2)C3=CC=C(C=C3)Br)C(=O)NC4=CC=C(C=C4)OS(=O)(=O)N |
Computed by PubChem (NCBI)