CAS 1807521-02-3 appears in our catalog under these names: PEP azide, 95%, PEP azide. Offered by: Lumiprobe, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[4-(2-pyren-2-ylethynyl)phenyl]butanamide (CAS 1807521-02-3) is a chemical compound with the molecular formula C34H32N4O3 and a molecular weight of 544.6 g/mol. IUPAC name: N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[4-(2-pyren-2-ylethynyl)phenyl]butanamide. InChIKey: SUCRAUNHFQZTRB-UHFFFAOYSA-N.
| Molecular formula | C34H32N4O3 |
|---|---|
| Molecular weight | 544.6 g/mol |
| IUPAC name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-[4-(2-pyren-2-ylethynyl)phenyl]butanamide |
| InChIKey | SUCRAUNHFQZTRB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC(=C4)C#CC5=CC=C(C=C5)CCCC(=O)NCCOCCOCCN=[N+]=[N-])C=C2 |
Computed by PubChem (NCBI)