CAS 1807523-99-4 appears in our catalog under these names: 4-(Methylsulfonyl)-1-(3-((5-methyl-3-(3-(4-(trifluoromethoxy)phenyl)-1,2,4-oxadiazol-5-yl)-1H-1,2,4-triazol-1-yl)methyl)phenyl)piperidine Hydrochloride (IACS-010759 HCl), IACS-010759 HCl, 97%, IACS-010759 hydrochloride, IACS-010759 (hydrochloride), IACS-010759 (hydrochloride), 99.66%. Offered by: TRC, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 2mg, 5mg, 1mg, 10mg, 25mg, 50mg.
IACS-10759 Hydrochloride is an inhibitor of mitochondrial complex I of oxidative phosphorylation (OXPHOS), contributing to programmed cell death for acute myeloid leukemia and brain cancers that require OXPHOS.
Source: ChEBI
| Molecular formula | C25H26ClF3N6O4S |
|---|---|
| Molecular weight | 599.0 g/mol |
| IUPAC name | 5-[5-methyl-1-[[3-(4-methylsulfonylpiperidin-1-yl)phenyl]methyl]-1,2,4-triazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole;hydrochloride |
| InChIKey | LUSCFOVOISLXTM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1CC2=CC(=CC=C2)N3CCC(CC3)S(=O)(=O)C)C4=NC(=NO4)C5=CC=C(C=C5)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)