CAS 1807530-14-8 appears in our catalog under these names: Pentynoic acid STP ester, 95%, Pentynoic acid STP ester sodium 98%, Pentynoic acid STP ester (sodium), 99.84%. Offered by: Lumiprobe, Ambeed, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 10 mg, 50 mg.
Sodium 2,3,5,6-tetrafluoro-4-pent-4-ynoyloxybenzenesulfonate (CAS 1807530-14-8) is a chemical compound with the molecular formula C11H5F4NaO5S and a molecular weight of 348.20 g/mol. IUPAC name: sodium 2,3,5,6-tetrafluoro-4-pent-4-ynoyloxybenzenesulfonate. InChIKey: QVSTTZKAIDTZNG-UHFFFAOYSA-M.
| Molecular formula | C11H5F4NaO5S |
|---|---|
| Molecular weight | 348.20 g/mol |
| IUPAC name | sodium 2,3,5,6-tetrafluoro-4-pent-4-ynoyloxybenzenesulfonate |
| InChIKey | QVSTTZKAIDTZNG-UHFFFAOYSA-M |
| SMILES | C#CCCC(=O)OC1=C(C(=C(C(=C1F)F)S(=O)(=O)[O-])F)F.[Na+] |
Computed by PubChem (NCBI)