CAS 1807537-35-4 appears in our catalog under these names: Tos-peg3-ch2co2h, 95%, Tos–PEG2–CH2COOH, Tos-PEG3-CH2CO2H, Tos-peg3-ch2co2h 98%, 2-[2-[2-[[(4-Methylphenyl)sulfonyl]oxy]ethoxy]ethoxy]acetic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 500mg, 100mg, 5g, 1 g, 50 mg, 100 mg.
2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetic acid (CAS 1807537-35-4) is a chemical compound with the molecular formula C13H18O7S and a molecular weight of 318.34 g/mol. IUPAC name: 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetic acid. InChIKey: QQHWSZBWDYTXGD-UHFFFAOYSA-N.
| Molecular formula | C13H18O7S |
|---|---|
| Molecular weight | 318.34 g/mol |
| IUPAC name | 2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]acetic acid |
| InChIKey | QQHWSZBWDYTXGD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC(=O)O |
Computed by PubChem (NCBI)