CAS 1807537-42-3 appears in our catalog under these names: Mal-peg5-nhs ester, 95%, Mal–PEG5–NHS ester, Mal-PEG5-NHS ester, Mal-PEG5-NHS ester 95%, Mal-PEG5-NHS ester, 99.04%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 250mg, 100mg, 10mg, 25mg, 50mg, 500mg, 1g, 10 mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1807537-42-3) is a chemical compound with the molecular formula C21H30N2O11 and a molecular weight of 486.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: PDFXZGGPCFZXJU-UHFFFAOYSA-N.
| Molecular formula | C21H30N2O11 |
|---|---|
| Molecular weight | 486.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | PDFXZGGPCFZXJU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)